5-bromo-3-fluoro-2-methoxyaniline

5-bromo-3-fluoro-2-methoxyaniline

5-bromo-4-methoxy-2-nitrobenzaldehyde

5-bromo-4-methoxy-2-nitrobenzaldehyde

5-bromo-3-fluoro-2-methylbenzoic acid

$250.00
CAS No.: 1427433-28-0
Catalog No.: 194086
Purity: 95%
MF: C8H6BrFO2
MW: 233.036
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C(=C(C(=O)O)C1)C)F
Availability:
In stock
SKU
194086
  • Size
    Price
    Stock
    Estimated Shipping Time
5-bromo-3-fluoro-2-methylbenzoic acid; CAS No.: 1427433-28-0; 5-bromo-3-fluoro-2-methylbenzoic acid. PROPERTIES: 5-bromo-3-fluoro-2-methylbenzoic acid is a white crystalline powder. Its molecular formula is C8H6BrFO2, with a molecular weight of approximately 233.04 g/mol. The compound has a melting point of approximately 130-132 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and ethyl acetate. For stable storage, it should be kept in a tightly sealed container at room temperature, away from heat and direct sunlight. As a carboxylic acid compound containing bromine and fluorine atoms, it may exhibit certain corrosivity and toxicity. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In the chemical industry, 5-bromo-3-fluoro-2-methylbenzoic acid can be used as a raw material for the synthesis of various organic compounds. The carboxylic acid group can undergo reactions such as esterification, amidation, and formation of acid chlorides. The bromine and fluorine atoms provide opportunities for further functionalization. In the pharmaceutical field, derivatives of 5-bromo-3-fluoro-2-methylbenzoic acid can be explored as potential drug candidates. For example, in the development of certain non-steroidal anti-inflammatory drugs (NSAIDs), the structure of this compound can be modified to enhance the drug's anti-inflammatory and analgesic effects (as described in pharmaceutical chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional polymers or liquid crystal materials, where the combination of bromine, fluorine, and the methyl group can influence the material's properties (as mentioned in materials chemistry literature).

Reviews

Write Your Own Review
You're reviewing:5-bromo-3-fluoro-2-methylbenzoic acid
Your Rating