5-bromo-1-fluoro-3-methoxy-2-nitrobenzene
$250.00
CAS No.: 1137869-91-0
Catalog No.: 194078
Purity: 95%
MF: C7H5BrFNO3
MW: 250.023
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C(=C(C1)F)[N+](=O)[O-])OC
Catalog No.: 194078
Purity: 95%
MF: C7H5BrFNO3
MW: 250.023
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C(=C(C1)F)[N+](=O)[O-])OC
5-bromo-1-fluoro-3-methoxy-2-nitrobenzene; CAS No.: 1137869-91-0; 5-bromo-1-fluoro-3-methoxy-2-nitrobenzene. PROPERTIES: 5-bromo-1-fluoro-3-methoxy-2-nitrobenzene is a viscous liquid. Its molecular formula is C7H4BrFNO3, and the molecular weight is approximately 254.01 g/mol. The compound has a boiling point of around 150-152 C at reduced pressure. It is moderately soluble in organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. Proper storage conditions involve keeping it in a sealed, amber glass bottle at 2-8 C, protected from light and moisture. As a compound containing multiple functional groups such as bromine, fluorine, methoxy, and nitro, it may possess certain reactivity and toxicity. When handling it, protective gloves, eye protection, and a lab coat should be worn. In case of skin contact, washing with soap and water is recommended, and in case of eye contact, thorough rinsing with water is required. APPLICATIONS: In the field of organic synthesis, 5-bromo-1-fluoro-3-methoxy-2-nitrobenzene is a versatile starting material. The bromine atom can undergo substitution or coupling reactions, the nitro group can be reduced to an amine group, and the fluorine and methoxy groups can influence the reactivity and selectivity of the aromatic ring. In the preparation of pharmaceutical intermediates, 5-bromo-1-fluoro-3-methoxy-2-nitrobenzene can be used to synthesize compounds with specific biological activities. For instance, in the development of certain antidepressant drugs, the unique substituents of this compound can be utilized to design drugs with improved efficacy and fewer side effects (as reported in pharmaceutical chemistry journals). Furthermore, in the field of agrochemical synthesis, it can serve as a precursor for the preparation of novel herbicides or pesticides, where its functional groups can enhance the compounds' selectivity and effectiveness (as mentioned in agrochemical chemistry research papers).
Reviews
Write Your Own Review