4-propylphenylacetic acid

4-propylphenylacetic acid

5-amino-2-methoxy-4-nitrobenzonitrile

5-amino-2-methoxy-4-nitrobenzonitrile

5-amino-2-(trifluoromethyl)benzonitrile

$200.00
CAS No.: 354814-19-0
Catalog No.: 194076
Purity: 95%
MF: C8H5F3N2
MW: 186.136
Storage: 2-8 degree Celsius
SMILES: NC=1C=CC(=C(C#N)C1)C(F)(F)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194076
  • Size
    Price
    Stock
    Estimated Shipping Time
5-amino-2-(trifluoromethyl)benzonitrile; CAS No.: 354814-19-0; 5-amino-2-(trifluoromethyl)benzonitrile. PROPERTIES: 5-amino-2-(trifluoromethyl)benzonitrile is a crystalline solid. Its molecular formula is C7H4F3N3, and the molecular weight is approximately 203.12 g/mol. The compound has a melting point of about 110-112 C. It is moderately soluble in polar aprotic solvents such as DMSO and DMF, but has limited solubility in water. Proper storage conditions involve keeping it in a sealed container at 2-8 C, protected from moisture and light. When handling this compound, protective gloves, eye protection, and a lab coat should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is required. APPLICATIONS: In the chemical synthesis domain, 5-amino-2-(trifluoromethyl)benzonitrile serves as a valuable intermediate. The amino group can undergo reactions such as acylation, alkylation, and formation of Schiff bases. The trifluoromethyl and cyano groups provide unique electronic properties to the molecule, making it suitable for the synthesis of various heterocyclic compounds. In the pharmaceutical industry, derivatives of 5-amino-2-(trifluoromethyl)benzonitrile can be explored as potential therapeutic agents. For instance, in the development of antimicrobial drugs, the substituents of 5-amino-2-(trifluoromethyl)benzonitrile can be utilized to design compounds with enhanced antibacterial or antifungal activity (as reported in pharmaceutical chemistry journals). Moreover, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where the combination of amino, trifluoromethyl, and cyano groups can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:5-amino-2-(trifluoromethyl)benzonitrile
Your Rating