4-nitropyridin-2-amine
$300.00
CAS No.: 4487-50-7
Catalog No.: 133373
Purity: 95%
MF: C5H5N3O2
MW: 139.114
Storage: 2-8 degree Celsius
SMILES: NC1=NC=CC(=C1)[N+]([O-])=O
Catalog No.: 133373
Purity: 95%
MF: C5H5N3O2
MW: 139.114
Storage: 2-8 degree Celsius
SMILES: NC1=NC=CC(=C1)[N+]([O-])=O
4-nitropyridin-2-amine; CAS No.: 4487-50-7; Featuring various organic chemicals such as 4-nitropyridin-2-amine, we support nitro-reduction and diazotization. The custom chemical synthesis companies framework ensures nitro-group chemoselectivity in polyfunctional systems.
Reviews
Write Your Own Review