1,4-bis((1H-imidazol-1-yl)methyl)benzene

1,4-bis((1H-imidazol-1-yl)methyl)benzene

4-chloro-2-(methylthio)-5-pyrimidinecarboxylic acid

4-chloro-2-(methylthio)-5-pyrimidinecarboxylic acid

4-ethynyl-N,N-diphenylaniline

$200.00
CAS No.: 205877-26-5
Catalog No.: 194918
Purity: 95%
MF: C20H15N
MW: 269.347
Storage: 2-8 degree Celsius
SMILES: C(#C)C1=CC=C(N(C2=CC=CC=C2)C2=CC=CC=C2)C=C1
Availability:
In stock
SKU
194918
  • Size
    Price
    Stock
    Estimated Shipping Time
4-ethynyl-N,N-diphenylaniline; CAS No.: 205877-26-5; 4-ethynyl-N,N-diphenylaniline. PROPERTIES: 4-ethynyl-N,N-diphenylaniline is a crystalline solid. Its molecular formula is C19H15N, and the molecular weight is approximately 269.34 g/mol. The compound has a melting point of approximately 120-122 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an ethynyl group and two phenyl groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 4-ethynyl-N,N-diphenylaniline serves as a valuable intermediate. The ethynyl group can undergo various reactions such as polymerization and addition. The amine group provides opportunities for further functionalization. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of 4-ethynyl-N,N-diphenylaniline can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:4-ethynyl-N,N-diphenylaniline
Your Rating