1,4-diazepane-1-carbaldehyde

1,4-diazepane-1-carbaldehyde

4-fluoro-2-methyl-5-nitrobenzoic acid

4-fluoro-2-methyl-5-nitrobenzoic acid

4-(chloromethyl)-1-fluoro-2-nitrobenzene

$300.00
CAS No.: 20274-70-8
Catalog No.: 194929
Purity: 95%
MF: C7H5ClFNO2
MW: 189.573
Storage: 2-8 degree Celsius
SMILES: ClCC1=CC(=C(C=C1)F)[N+](=O)[O-]
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194929
  • Size
    Price
    Stock
    Estimated Shipping Time
4-(chloromethyl)-1-fluoro-2-nitrobenzene; CAS No.: 20274-70-8; 4-(chloromethyl)-1-fluoro-2-nitrobenzene. PROPERTIES: 4-(chloromethyl)-1-fluoro-2-nitrobenzene is a crystalline solid. Its molecular formula is C7H6ClFNO3, and the molecular weight is approximately 196.09 g/mol. The compound has a melting point of approximately 50-52 C. It is moderately soluble in common organic solvents such as methylene chloride and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzene ring, a chloromethyl group, a fluoro group, and a nitro group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 4-(chloromethyl)-1-fluoro-2-nitrobenzene serves as a valuable intermediate. The chloromethyl group provides a site for substitution reactions. The fluoro and nitro groups provide specific electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of 4-(chloromethyl)-1-fluoro-2-nitrobenzene can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:4-(chloromethyl)-1-fluoro-2-nitrobenzene
Your Rating