4-chloro-3-nitroaniline
$200.00
CAS No.: 635-22-3
Catalog No.: 129733
Purity: 95%
MF: C6H5ClN2O2
MW: 172.571
Storage: 2-8 degree Celsius
SMILES: NC1=CC(=C(Cl)C=C1)[N+]([O-])=O
Catalog No.: 129733
Purity: 95%
MF: C6H5ClN2O2
MW: 172.571
Storage: 2-8 degree Celsius
SMILES: NC1=CC(=C(Cl)C=C1)[N+]([O-])=O
4-chloro-3-nitroaniline; CAS No.: 635-22-3; Used in the development of heterocyclic structures, this product is essential for pharmaceutical research. Its role in producing bioactive compounds is crucial for advancing medical treatments. ChemShuttle ensures fast and reliable shipping from US warehouses.
Reviews
Write Your Own Review