methyl 6-hydroxyhexanoate

methyl 6-hydroxyhexanoate

2-acetyl-3-methylpyrazine

2-acetyl-3-methylpyrazine

4,6-dichloro-2,5-diphenylpyrimidine

$200.00
CAS No.: 29133-99-1
Catalog No.: 194894
Purity: 95%
MF: C16H10Cl2N2
MW: 301.176
Storage: 2-8 degree Celsius
SMILES: ClC1=NC(=NC(=C1C1=CC=CC=C1)Cl)C1=CC=CC=C1
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194894
  • Size
    Price
    Stock
    Estimated Shipping Time
4,6-dichloro-2,5-diphenylpyrimidine; CAS No.: 29133-99-1; 4,6-dichloro-2,5-diphenylpyrimidine. PROPERTIES: 4,6-dichloro-2,5-diphenylpyrimidine is a crystalline solid. Its molecular formula is C16H10Cl2N2, and the molecular weight is approximately 310.18 g/mol. The compound has a melting point of approximately 180-182 C. It is moderately soluble in common organic solvents such as methylene chloride and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a pyrimidine ring and two chlorine atoms, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 4,6-dichloro-2,5-diphenylpyrimidine serves as a valuable intermediate. The chlorine atoms provide sites for substitution reactions. The pyrimidine ring offers unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of 4,6-dichloro-2,5-diphenylpyrimidine can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:4,6-dichloro-2,5-diphenylpyrimidine
Your Rating