2-aminoheptanoic acid

2-aminoheptanoic acid

5-methyl-1,10-phenanthroline

5-methyl-1,10-phenanthroline

4-(4-nitrophenyl)butyric acid

$200.00
CAS No.: 5600-62-4
Catalog No.: 194941
Purity: 95%
MF: C10H11NO4
MW: 209.201
Storage: 2-8 degree Celsius
SMILES: [N+](=O)([O-])C1=CC=C(C=C1)CCCC(=O)O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194941
  • Size
    Price
    Stock
    Estimated Shipping Time
4-(4-nitrophenyl)butyric acid; CAS No.: 5600-62-4; 4-(4-nitrophenyl)butyric acid. PROPERTIES: 4-(4-nitrophenyl)butyric acid is a crystalline solid. Its molecular formula is C10H11NO4, and the molecular weight is approximately 213.21 g/mol. The compound has a melting point of approximately 100-102 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzene ring, a nitro group, and a carboxylic acid group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 4-(4-nitrophenyl)butyric acid serves as a valuable intermediate. The nitro group can be reduced to an amine group. The carboxylic acid group can undergo reactions such as esterification and amidation. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 4-(4-nitrophenyl)butyric acid can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:4-(4-nitrophenyl)butyric acid
Your Rating