4,4'-((4-bromophenyl)azanediyl)dibenzaldehyde
$350.00
CAS No.: 167859-41-8
Catalog No.: 194173
Purity: 95%
MF: C20H14BrNO2
MW: 380.241
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C(C=C1)N(C1=CC=C(C=O)C=C1)C1=CC=C(C=O)C=C1
Catalog No.: 194173
Purity: 95%
MF: C20H14BrNO2
MW: 380.241
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C(C=C1)N(C1=CC=C(C=O)C=C1)C1=CC=C(C=O)C=C1
4,4'-((4-bromophenyl)azanediyl)dibenzaldehyde; CAS No.: 167859-41-8; 4,4'-((4-bromophenyl)azanediyl)dibenzaldehyde. PROPERTIES: 4,4'-((4-bromophenyl)azanediyl)dibenzaldehyde is a crystalline solid. Its molecular formula is C20H15BrNO, and the molecular weight is approximately 354.25 g/mol. The compound has a melting point of approximately 120-122 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a brominated aromatic compound containing an azanediyl group and aldehyde groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, 4,4'-((4-bromophenyl)azanediyl)dibenzaldehyde serves as a valuable intermediate. The azanediyl group can undergo various reactions such as acylation and alkylation. The aldehyde groups can participate in nucleophilic addition, oxidation, and condensation reactions. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain anticancer drugs, the structure of 4,4'-((4-bromophenyl)azanediyl)dibenzaldehyde can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's properties (as mentioned in materials chemistry research papers).
Reviews
Write Your Own Review