(3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)tetrahydro-2H-pyran-2,4,5-triol hydrochloride
$250.00
CAS No.: 1772-03-8
Catalog No.: 101746
Purity: 95%
MF: C6H14ClNO5
MW: 215.633
Storage: 2-8 degree Celsius
SMILES: Cl[H].N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O
Catalog No.: 101746
Purity: 95%
MF: C6H14ClNO5
MW: 215.633
Storage: 2-8 degree Celsius
SMILES: Cl[H].N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O
(3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)tetrahydro-2H-pyran-2,4,5-triol hydrochloride; CAS No.: 1772-03-8; ChemShuttle, a chemical synthesis company, provides compounds such as (3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)tetrahydro-2H-pyran-2,4,5-triol hydrochloride. As a Leading Chemicals Distributor, it specializes in offering key intermediates for drug development. The company's expertise in chemical building blocks makes it a valuable resource for scientists seeking to advance their research.
Reviews
Write Your Own Review