3-ethyl-5-(2-hydroxyethyl)-4-methylthiazol-3-ium bromide
$300.00
CAS No.: 54016-70-5
Catalog No.: 189172
Purity: 95%
MF: C8H14BrNOS
MW: 252.177
Storage: 2-8 degree Celsius
SMILES: [Br-].C(C)[N+]1=CSC(=C1C)CCO
Catalog No.: 189172
Purity: 95%
MF: C8H14BrNOS
MW: 252.177
Storage: 2-8 degree Celsius
SMILES: [Br-].C(C)[N+]1=CSC(=C1C)CCO
3-ethyl-5-(2-hydroxyethyl)-4-methylthiazol-3-ium bromide; CAS No.: 54016-70-5; 3-ethyl-5-(2-hydroxyethyl)-4-methylthiazol-3-ium bromide is part of Chem Shuttle's collection of thiazolium salts that serve as key intermediates in organic synthesis. As a leading chemicals distributor, Chem Shuttle specializes in producing thiazolium derivatives with hydroxyethyl and ethyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals. This compound, with its thiazolium ring and bromide counterion, is particularly valuable as a building block for the production of bioactive molecules with specific ionic properties. Chem Shuttle's custom compound synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the discovery of novel therapeutic agents. The company's focus on chemical blocks ensures that researchers can obtain high-purity 3-ethyl-5-(2-hydroxyethyl)-4-methylthiazol-3-ium bromide, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review