3-bromo-2,4-difluorobenzoic acid
$315.00
CAS No.: 651026-98-1
Catalog No.: 190217
Purity: 95%
MF: C7H3BrF2O2
MW: 236.999
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=C(C(=O)O)C=CC1F)F
Catalog No.: 190217
Purity: 95%
MF: C7H3BrF2O2
MW: 236.999
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=C(C(=O)O)C=CC1F)F
For R&D use only. Not for human or animal use.
3-bromo-2,4-difluorobenzoic acid; CAS No.: 651026-98-1; 3-bromo-2,4-difluorobenzoic acid is part of Chem Shuttle's collection of bromodifluorobenzoic acids that serve as key intermediates in organic synthesis. As a custom chemical synthesis company, Chem Shuttle specializes in producing benzoic acid derivatives with bromo and fluoro substituents that are crucial for the development of various pharmaceuticals and agrochemicals. This compound, with its bromo and difluoro groups, serves as a valuable building block for the synthesis of bioactive molecules with specific receptor affinities. Chem Shuttle's online chemical mall provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that 3-bromo-2,4-difluorobenzoic acid is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review