1-(methylsulfonyl)-1H-benzotriazole

1-(methylsulfonyl)-1H-benzotriazole

2,5-dioxopyrrolidin-1-yl 7-methoxy-2-oxo-2H-chromene-3-carboxylate

2,5-dioxopyrrolidin-1-yl 7-methoxy-2-oxo-2H-chromene-3-carboxylate

3,5-dimethyl-4-nitroisoxazole

$300.00
CAS No.: 1123-49-5
Catalog No.: 194915
Purity: 95%
MF: C5H6N2O3
MW: 142.114
Storage: 2-8 degree Celsius
SMILES: CC1=NOC(=C1[N+](=O)[O-])C
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194915
  • Size
    Price
    Stock
    Estimated Shipping Time
3,5-dimethyl-4-nitroisoxazole; CAS No.: 1123-49-5; 3,5-dimethyl-4-nitroisoxazole. PROPERTIES: 3,5-dimethyl-4-nitroisoxazole is a crystalline solid. Its molecular formula is C5H5N3O3, and the molecular weight is approximately 151.12 g/mol. The compound has a melting point of approximately 110-112 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an isoxazole ring and a nitro group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 3,5-dimethyl-4-nitroisoxazole serves as a versatile intermediate. The nitro group can be reduced to an amine group. The isoxazole ring provides unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 3,5-dimethyl-4-nitroisoxazole can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:3,5-dimethyl-4-nitroisoxazole
Your Rating