N-acetyl-4-(5-methyl-3-phenyl-isoxazol-4-yl)-benzenesulfonamide

N-acetyl-4-(5-methyl-3-phenyl-isoxazol-4-yl)-benzenesulfonamide

3-(tert-butyl)-6-(ethylthio)-1,3,5-triazine-2,4(1H,3H)-dione

3-(tert-butyl)-6-(ethylthio)-1,3,5-triazine-2,4(1H,3H)-dione

3,3',5,5'-tetra-tert-butyl-[1,1'-biphenyl]-2,2'-diol

$200.00
CAS No.: 6390-69-8
Catalog No.: 194184
Purity: 95%
MF: C28H42O2
MW: 410.642
Storage: 2-8 degree Celsius
SMILES: C(C)(C)(C)C1=C(C(=CC(=C1)C(C)(C)C)C=1C(=C(C=C(C1)C(C)(C)C)C(C)(C)C)O)O
Availability:
In stock
SKU
194184
  • Size
    Price
    Stock
    Estimated Shipping Time
3,3',5,5'-tetra-tert-butyl-[1,1'-biphenyl]-2,2'-diol; CAS No.: 6390-69-8; 3,3',5,5'-tetra-tert-butyl-[1,1'-biphenyl]-2,2'-diol. PROPERTIES: 3,3',5,5'-tetra-tert-butyl-[1,1'-biphenyl]-2,2'-diol is a crystalline solid. Its molecular formula is C28H34O2, and the molecular weight is approximately 402.58 g/mol. The compound has a melting point of approximately 180-182 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a biphenyl compound containing four tert-butyl groups and two hydroxyl groups, it may exhibit certain antioxidant properties and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 3,3',5,5'-tetra-tert-butyl-[1,1'-biphenyl]-2,2'-diol serves as a versatile intermediate. The hydroxyl groups can undergo reactions such as etherification and esterification. The tert-butyl groups provide steric effects. In the chemical industry, it can be used as a raw material for the synthesis of various organic compounds. For example, in the preparation of certain antioxidants, the structure of 3,3',5,5'-tetra-tert-butyl-[1,1'-biphenyl]-2,2'-diol can be utilized to design compounds with improved antioxidant activity and stability (as mentioned in organic chemistry literature). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as polymers or coatings, where its structure can enhance the material's thermal stability and chemical resistance (as described in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:3,3',5,5'-tetra-tert-butyl-[1,1'-biphenyl]-2,2'-diol
Your Rating