2-(tert-butyl)-1H-benzo[d]imidazol-5-amine
$200.00
CAS No.: 177843-66-2
Catalog No.: 189058
Purity: 95%
MF: C11H15N3
MW: 189.262
Storage: 2-8 degree Celsius
SMILES: C(C)(C)(C)C1=NC2=C(N1)C=CC(=C2)N
Catalog No.: 189058
Purity: 95%
MF: C11H15N3
MW: 189.262
Storage: 2-8 degree Celsius
SMILES: C(C)(C)(C)C1=NC2=C(N1)C=CC(=C2)N
For R&D use only. Not for human or animal use.
![tert-butyl (S)-7-amino-5-oxa-2-azaspiro[3.4]octane-2-carboxylate hydrochloride](https://www.chemshuttle.com/media/catalog/product/cache/eda3e020a548044183bce7a8a96486f8/y/q/yqf2728_1.jpg)
2-(tert-butyl)-1H-benzo[d]imidazol-5-amine; CAS No.: 116008-37-8 This substance is characterized by its specific chemical behavior and is used in the production of specialty chemicals. Its applications include the synthesis of complex organic molecules for various industrial uses.
Reviews
Write Your Own Review