tert-butyl 5-oxo-2-azabicyclo[2.2.1]heptane-2-carboxylate

tert-butyl 5-oxo-2-azabicyclo[2.2.1]heptane-2-carboxylate

tert-butyl 2,6-diazaspiro[3.4]octane-2-carboxylate hydrochloride

tert-butyl 2,6-diazaspiro[3.4]octane-2-carboxylate hydrochloride

(2-(tert-butoxycarbonyl)-1,2,3,4-tetrahydroisoquinolin-6-yl)boronic acid

$200.00
CAS No.: 1312765-94-8
Catalog No.: 164918
Purity: 95%
MF: C14H20BNO4
MW: 277.129
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=C2)B(O)O
Availability:
In stock
SKU
164918
  • Size
    Price
    Stock
    Estimated Shipping Time
(2-(tert-butoxycarbonyl)-1,2,3,4-tetrahydroisoquinolin-6-yl)boronic acid; CAS No.: 1312765-94-8; (2-(tert-butoxycarbonyl)-1,2,3,4-tetrahydroisoquinolin-6-yl)boronic acid is part of ChemShuttle's collection of various organic chemicals, which are used extensively in chemical research and synthesis. As a various organic chemical with unique structural features, this compound highlights the company's ability to supply specialized building blocks for the development of new pharmaceuticals. The various organic chemicals offered by ChemShuttle, including (2-(tert-butoxycarbonyl)-1,2,3,4-tetrahydroisoquinolin-6-yl)boronic acid (CAS No.: 1312765-94-8), are essential for enabling researchers to construct complex molecules with potential therapeutic applications. These various organic chemicals serve as the foundation for numerous custom synthesis projects, facilitating the exploration of new chemical spaces in the quest for potential drug candidates. By supplying a diverse array of various organic chemicals, ChemShuttle ensures that scientists have access to the necessary components to advance their research. The (2-(tert-butoxycarbonyl)-1,2,3,4-tetrahydroisoquinolin-6-yl)boronic acid (CAS No.: 1312765-94-8) exemplifies the company's dedication to providing high-quality building blocks that contribute to innovation in chemical synthesis.

Reviews

Write Your Own Review
You're reviewing:(2-(tert-butoxycarbonyl)-1,2,3,4-tetrahydroisoquinolin-6-yl)boronic acid
Your Rating