1,2-naphthalenedicarbonitrile

1,2-naphthalenedicarbonitrile

2-bromobutyramide

2-bromobutyramide

2-(dimethylamino)-5-methoxybenzaldehyde

$600.00
CAS No.: 190142-96-2
Catalog No.: 194957
Purity: 95%
MF: C10H13NO2
MW: 179.219
Storage: 2-8 degree Celsius
SMILES: CN(C1=C(C=O)C=C(C=C1)OC)C
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194957
  • Size
    Price
    Stock
    Estimated Shipping Time
2-(dimethylamino)-5-methoxybenzaldehyde; CAS No.: 190142-96-2; 2-(dimethylamino)-5-methoxybenzaldehyde. PROPERTIES: 2-(dimethylamino)-5-methoxybenzaldehyde is a crystalline solid. Its molecular formula is C9H11NO2, and the molecular weight is approximately 173.19 g/mol. The compound has a melting point of approximately 60-62 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an amine group, a methoxy group, and an aldehyde group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 2-(dimethylamino)-5-methoxybenzaldehyde serves as a versatile intermediate. The aldehyde group can undergo various reactions such as nucleophilic addition, reduction, and condensation. The amine and methoxy groups provide specific electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 2-(dimethylamino)-5-methoxybenzaldehyde can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:2-(dimethylamino)-5-methoxybenzaldehyde
Your Rating