2-chloro-3-nitrobenzenesulfonyl chloride
$250.00
CAS No.: 15945-25-2
Catalog No.: 193920
Purity: 95%
MF: C6H3Cl2NO4S
MW: 256.066
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=CC=C1[N+](=O)[O-])S(=O)(=O)Cl
Catalog No.: 193920
Purity: 95%
MF: C6H3Cl2NO4S
MW: 256.066
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=CC=C1[N+](=O)[O-])S(=O)(=O)Cl
For R&D use only. Not for human or animal use.
2-chloro-3-nitrobenzenesulfonyl chloride; CAS No.: 15945-25-2;2-chloro-3-nitrobenzenesulfonyl chloride. PROPERTIES: 2-chloro-3-nitrobenzenesulfonyl chloride is a chlorinated and nitrated aromatic sulfonyl chloride with molecular formula C6H4Cl2NO3S. It typically exists as a colorless to pale yellow liquid with a boiling point around 140-145 C. The compound has limited water solubility but dissolves well in organic solvents like chloroform or carbon tetrachloride. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong bases, releasing toxic sulfur-containing fumes. Proper storage involves keeping it in tightly sealed containers below 25 C, away from heat sources and incompatible materials. APPLICATIONS: In organic synthesis, this compound serves as a versatile building block for creating complex aromatic systems. The chloro and nitro substituents provide multiple sites for cross-coupling and nucleophilic substitution reactions, while the sulfonyl chloride group enables formation of sulfonamides or sulfonate esters (The Journal of Organic Chemistry). In pharmaceutical development, 2-chloro-3-nitrobenzenesulfonyl chloride contributes to the synthesis of antimicrobial agents where the halogenated aromatic scaffold enhances binding to microbial targets (Antimicrobial Agents and Chemotherapy). The compound also finds application in materials science as a building block for organic electronics, where its electron-deficient aromatic core modulates the electronic properties of derived materials (Journal of Materials Chemistry C).
Reviews
Write Your Own Review