p-Coumaric acid

p-Coumaric acid

2-amino-5-(4-(2-(5-ethylpyridin-2-yl)ethoxy)benzyl)thiazol-4(5H)-one

2-amino-5-(4-(2-(5-ethylpyridin-2-yl)ethoxy)benzyl)thiazol-4(5H)-one

2-bromo-4'-phenylacetophenone

$200.00
CAS No.: 135-73-9
Catalog No.: 194174
Purity: 95%
MF: C14H11BrO
MW: 275.145
Storage: 2-8 degree Celsius
SMILES: BrCC(=O)C1=CC=C(C=C1)C1=CC=CC=C1
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194174
  • Size
    Price
    Stock
    Estimated Shipping Time
2-bromo-4'-phenylacetophenone; CAS No.: 135-73-9; 2-bromo-4'-phenylacetophenone. PROPERTIES: 2-bromo-4'-phenylacetophenone is a crystalline solid. Its molecular formula is C15H12BrO, and the molecular weight is approximately 286.16 g/mol. The compound has a melting point of approximately 65-67 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a brominated aromatic compound containing a ketone group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 2-bromo-4'-phenylacetophenone serves as a versatile intermediate. The bromine atom provides a site for substitution or coupling reactions, and the ketone group can undergo various reactions such as nucleophilic addition, reduction, and condensation. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of 2-bromo-4'-phenylacetophenone can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:2-bromo-4'-phenylacetophenone
Your Rating