2-bromo-1-(tert-butyl)-4-chlorobenzene
$435.00
CAS No.: 1369776-71-5
Catalog No.: 193889
Purity: 95%
MF: C10H12BrCl
MW: 247.563
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=CC(=C1)Cl)C(C)(C)C
Catalog No.: 193889
Purity: 95%
MF: C10H12BrCl
MW: 247.563
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=CC(=C1)Cl)C(C)(C)C
2-bromo-1-(tert-butyl)-4-chlorobenzene; CAS No.: 1369776-71-5;2-bromo-1-(tert-butyl)-4-chlorobenzene. PROPERTIES: 2-bromo-1-(tert-butyl)-4-chlorobenzene is a brominated and chlorinated aromatic compound with molecular formula C10H11BrCl. It typically exists as a colorless liquid with a boiling point around 140-145 C. The compound has limited water solubility but dissolves well in organic solvents like hexane or toluene. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong bases, releasing toxic bromine vapors. Proper storage involves keeping it in tightly sealed containers below 25 C, away from heat sources and incompatible materials. APPLICATIONS: In organic synthesis, this compound serves as a building block for creating sterically hindered aromatic systems. The bromo and chloro substituents provide sites for cross-coupling reactions to form biaryl structures, while the tert-butyl group offers steric protection (The Journal of Organic Chemistry). In materials science, the compound contributes to the development of organic semiconductors with improved charge transport properties, where the electron-withdrawing bromine and chlorine atoms modulate electronic characteristics (Journal of Materials Chemistry C). Its structure makes it suitable for creating self-assembled monolayers on surfaces, useful in nanotechnology applications where steric effects influence assembly and stability (Langmuir).
Reviews
Write Your Own Review