2,4-bis((trimethylsilyl)oxy)pyrimidine

2,4-bis((trimethylsilyl)oxy)pyrimidine

methyl 6-hydroxyhexanoate

methyl 6-hydroxyhexanoate

(2-amino-6-nitrophenyl)methanol

$150.00
CAS No.: 98451-51-5
Catalog No.: 194892
Purity: 95%
MF: C7H8N2O3
MW: 168.152
Storage: 2-8 degree Celsius
SMILES: NC1=C(C(=CC=C1)[N+](=O)[O-])CO
Availability:
In stock
SKU
194892
  • Size
    Price
    Stock
    Estimated Shipping Time
(2-amino-6-nitrophenyl)methanol; CAS No.: 98451-51-5; (2-amino-6-nitrophenyl)methanol. PROPERTIES: (2-amino-6-nitrophenyl)methanol is a crystalline solid. Its molecular formula is C7H8N2O3, and the molecular weight is approximately 172.16 g/mol. The compound has a melting point of approximately 100-102 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an amino group, a nitro group, and a hydroxyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, (2-amino-6-nitrophenyl)methanol serves as a versatile intermediate. The amino group can undergo various reactions such as acylation, sulfonation, and diazotization. The nitro group provides opportunities for reduction to an amine group. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of (2-amino-6-nitrophenyl)methanol can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:(2-amino-6-nitrophenyl)methanol
Your Rating