((((2,5-dioxopyrrolidin-1-yl)oxy)carbonyl)oxy)methyl pivalate
$350.00
CAS No.: 403656-27-9
Catalog No.: 198262
Purity: 95%
MF: C11H15NO7
MW: 273.241
Storage: 2-8 degree Celsius
SMILES: C(C(C)(C)C)(=O)OCOC(=O)ON1C(CCC1=O)=O
Catalog No.: 198262
Purity: 95%
MF: C11H15NO7
MW: 273.241
Storage: 2-8 degree Celsius
SMILES: C(C(C)(C)C)(=O)OCOC(=O)ON1C(CCC1=O)=O
CAS No.:403656-27-9;((((2,5-dioxopyrrolidin-1-yl)oxy)carbonyl)oxy)methyl pivalate;ChemShuttle distinguishes itself as a custom chemical synthesis company by providing unique building blocks such as the ((((2,5-dioxopyrrolidin-1-yl)oxy)carbonyl)oxy)methyl pivalate (CAS No.:403656-27-9). This compound combines the reactivity of a dioxopyrrolidine core with the stability imparted by the pivalate ester, making it an excellent candidate for custom compound synthesis. As a chemical online mall, we recognize the growing demand for such specialized heterocycles in the pharmaceutical industry. The carbonyl and ester functionalities provide valuable points for chemical modification, while the dioxopyrrolidine core adds structural diversity. Researchers can benefit from our expertise in small molecules synthesis to produce this compound in the quantities needed for their experiments, supported by our full-time equivalent model that dedicates resources specifically to their projects.
Reviews
Write Your Own Review