2,4-dimethylbenzyl bromide

2,4-dimethylbenzyl bromide

2,5-dibromo-1,4-phenylenediamine

2,5-dibromo-1,4-phenylenediamine

2,5-diamino-1,4-benzenedithiol dihydrochloride

$200.00
CAS No.: 75464-52-7
Catalog No.: WLZ1602
Purity: 95%
MF: C6H10Cl2N2S2
MW: 245.2
Storage: 2-8 degree Celsius
SMILES: Cl.Cl.NC1=C(C=C(C(=C1)S)N)S
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
WLZ1602
  • Size
    Price
    Stock
    Estimated Shipping Time
CAS NO.: 75464-52-7; 2,5-diamino-1,4-benzenedithiol dihydrochloride. PROPERTIES: This sulfur and nitrogen containing aromatic compound features two amino groups and two thiol groups on a benzene ring, creating a molecule with potential applications in organic synthesis and materials science. The 2,5-diamino-1,4-benzenedithiol dihydrochloride typically appears as a white to off-white crystalline solid with high aqueous solubility due to its salt form. Its molecular structure includes thiol and amino groups that can participate in various chemical reactions. For optimal stability and to prevent degradation, this compound should be stored at 2-8 degree Celsius in a tightly sealed container under anhydrous conditions. When handling, appropriate safety measures including nitrile gloves and safety goggles are essential. This compound is sensitive to moisture and may hydrolyze in aqueous environments. In case of accidental spillage, clean the area with a damp cloth and dispose of materials according to local regulations. APPLICATIONS: The 2,5-diamino-1,4-benzenedithiol dihydrochloride serves as a valuable intermediate in the synthesis of dyes, chelating agents, and pH indicators. The thiol and amino groups provide handles for further functionalization through reactions such as oxidation or alkylation. In materials science, this compound functions as a building block for creating conductive polymers and other advanced materials where sulfur and nitrogen-containing moieties impart specific electronic properties. Additionally, the molecule finds utility in chemical biology studies where its unique electronic properties can be harnessed for developing novel imaging agents and sensors. Researchers utilizing this compound benefit from its functional group versatility, enabling the development of diverse molecular architectures for applications ranging from analytical reagents to functional materials.

Reviews

Write Your Own Review
You're reviewing:2,5-diamino-1,4-benzenedithiol dihydrochloride
Your Rating