tert-Butyl(1-(hydroxymethyl)cyclobutyl)carbamate

tert-Butyl(1-(hydroxymethyl)cyclobutyl)carbamate

5-ethoxy-1,3-dimethylindolin-2-one

5-ethoxy-1,3-dimethylindolin-2-one

2-(4-ethyl-3-iodophenyl)-2-methylpropanoic acid

$300.00
CAS No.: 1256584-73-2
Catalog No.: 194187
Purity: 95%
MF: C12H15IO2
MW: 318.154
Storage: 2-8 degree Celsius
SMILES: C(C)C1=C(C=C(C=C1)C(C(=O)O)(C)C)I
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194187
  • Size
    Price
    Stock
    Estimated Shipping Time
2-(4-ethyl-3-iodophenyl)-2-methylpropanoic acid; CAS No.: 1256584-73-2; 2-(4-ethyl-3-iodophenyl)-2-methylpropanoic acid. PROPERTIES: 2-(4-ethyl-3-iodophenyl)-2-methylpropanoic acid is a crystalline solid. Its molecular formula is C13H16IO2, and the molecular weight is approximately 311.18 g/mol. The compound has a melting point of approximately 90-92 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an iodine atom and a carboxylic acid group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, 2-(4-ethyl-3-iodophenyl)-2-methylpropanoic acid serves as a valuable intermediate. The iodine atom provides a site for substitution or coupling reactions. The carboxylic acid group can undergo reactions such as esterification and amidation. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of 2-(4-ethyl-3-iodophenyl)-2-methylpropanoic acid can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:2-(4-ethyl-3-iodophenyl)-2-methylpropanoic acid
Your Rating