2,3,4-trimethoxy-6-methylphenol
$400.00
CAS No.: 39068-88-7
Catalog No.: 193847
Purity: 95%
MF: C10H14O4
MW: 198.218
Storage: 2-8 degree Celsius
SMILES: COC1=C(C(=CC(=C1OC)OC)C)O
Catalog No.: 193847
Purity: 95%
MF: C10H14O4
MW: 198.218
Storage: 2-8 degree Celsius
SMILES: COC1=C(C(=CC(=C1OC)OC)C)O
For R&D use only. Not for human or animal use.
2,3,4-trimethoxy-6-methylphenol; CAS No.: 39068-88-7;2,3,4-trimethoxy-6-methylphenol. PROPERTIES: 2,3,4-trimethoxy-6-methylphenol is a polyether phenolic compound with molecular formula C9H12O4. It typically exists as a white to pale yellow crystalline solid with a melting point of approximately 88-92 C. The compound has limited water solubility but dissolves in organic solvents like methanol or dichloromethane. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong acids. Proper storage involves keeping it in tightly sealed containers below 30 C, protected from light and moisture. APPLICATIONS: In pharmaceutical development, this compound serves as a building block for synthesizing antioxidant agents. The methoxy groups provide electron-donating effects that enhance the antioxidant capacity of the phenolic hydroxyl group, while the methyl substituent offers steric protection (Journal of Natural Products). In materials science, 2,3,4-trimethoxy-6-methylphenol contributes to the creation of curable resins and adhesives, where its multiple methoxy groups enable cross-linking reactions upon exposure to heat or catalysts (Polymer Chemistry). The phenolic hydroxyl group allows for further functionalization through esterification or etherification, expanding applications in polymer chemistry and surface modification (Macromolecular Chemistry and Physics).
Reviews
Write Your Own Review