1,3-dibenzyloxybenzene
$200.00
CAS No.: 3769-42-4
Catalog No.: 193825
Purity: 95%
MF: C20H18O2
MW: 290.362
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)OC1=CC(=CC=C1)OCC1=CC=CC=C1
Catalog No.: 193825
Purity: 95%
MF: C20H18O2
MW: 290.362
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)OC1=CC(=CC=C1)OCC1=CC=CC=C1
For R&D use only. Not for human or animal use.
1,3-dibenzyloxybenzene; CAS No.: 3769-42-4;1,3-dibenzyloxybenzene. PROPERTIES: 1,3-dibenzyloxybenzene is a diaryl ether compound with molecular formula C14H12O2. It typically exists as a colorless crystalline solid with a melting point of approximately 78-82 C. The compound has limited water solubility but dissolves in organic solvents like chloroform or acetone. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong acids. Proper storage involves keeping it in tightly sealed containers below 25 C, protected from light and moisture. APPLICATIONS: In organic synthesis, this compound serves as a building block for creating biaryl ethers through Suzuki-Miyaura coupling or other cross-coupling reactions. The benzyl ether groups provide temporary protection for hydroxyl functionalities, which can be removed under mild conditions (The Journal of Organic Chemistry). In materials science, 1,3-dibenzyloxybenzene contributes to the development of liquid crystalline materials, where its rigid aromatic structure influences mesophase behavior and thermal properties (Liquid Crystals). The compound also finds application in the synthesis of fluorescent probes and sensors, where its aromatic framework can be modified to create molecules with specific photophysical properties (Analytical Chemistry).
Reviews
Write Your Own Review