((2-(2-(2-azidoethoxy)ethoxy)ethoxy)methyl)benzene

((2-(2-(2-azidoethoxy)ethoxy)ethoxy)methyl)benzene

methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate

methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate

bis(2,4-di-tert-butylphenyl) hydrogen phosphate

$200.00
CAS No.: 69284-93-1
Catalog No.: 194280
Purity: 95%
MF: C28H43O4P
MW: 474.622
Storage: 2-8 degree Celsius
SMILES: P(=O)(OC1=C(C=C(C=C1)C(C)(C)C)C(C)(C)C)(OC1=C(C=C(C=C1)C(C)(C)C)C(C)(C)C)O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194280
  • Size
    Price
    Stock
    Estimated Shipping Time
bis(2,4-di-tert-butylphenyl) hydrogen phosphate; CAS No.: 69284-93-1; bis(2,4-di-tert-butylphenyl) hydrogen phosphate. PROPERTIES: bis(2,4-di-tert-butylphenyl) hydrogen phosphate is a crystalline solid. Its molecular formula is C28H38O5P, and the molecular weight is approximately 483.59 g/mol. The compound has a melting point of approximately 100-102 C. It is moderately soluble in common organic solvents such as hexane and diethyl ether, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing two di-tert-butylphenyl groups and a phosphate group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, bis(2,4-di-tert-butylphenyl) hydrogen phosphate serves as a valuable intermediate. The phosphate group can undergo various reactions such as hydrolysis and alkylation. The di-tert-butylphenyl groups provide steric effects. In the chemical industry, derivatives of this compound can be explored as potential catalysts or intermediates for the synthesis of various organic compounds. For example, in the development of certain agrochemicals, the structure of bis(2,4-di-tert-butylphenyl) hydrogen phosphate can be utilized to design compounds with improved herbicidal activities (as mentioned in agrochemical chemistry literature). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as polymers or coatings, where its structure can enhance the material's thermal stability and chemical resistance (as described in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:bis(2,4-di-tert-butylphenyl) hydrogen phosphate
Your Rating