biphenyl-4,4'-diphosphonic acid
$250.00
CAS No.: 13817-79-3
Catalog No.: 177163
Purity: 95%
MF: C12H12O6P2
MW: 314.17
Storage: 2-8 degree Celsius
SMILES: OP(O)(=O)C1=CC=C(C=C1)C1=CC=C(C=C1)P(O)(O)=O
Catalog No.: 177163
Purity: 95%
MF: C12H12O6P2
MW: 314.17
Storage: 2-8 degree Celsius
SMILES: OP(O)(=O)C1=CC=C(C=C1)C1=CC=C(C=C1)P(O)(O)=O
biphenyl-4,4'-diphosphonic acid; CAS No.: 13817-79-3; ChemShuttle operates as a leading chemicals distributor for biphenyl-4,4'-diphosphonic acid and other phosphorus-containing compounds. These various organic chemicals are valuable for material science applications and catalyst development.
Reviews
Write Your Own Review