benzyl cis-(4-(((tert-butoxycarbonyl)amino)methyl)cyclohexyl)carbamate
$300.00
CAS No.: 2384110-35-2
Catalog No.: 198297
Purity: 95%
MF: C20H30N2O4
MW: 362.47
Storage: 2-8 degree Celsius
SMILES: O=C(OCC1=CC=CC=C1)N[C@H]2CC[C@@H](CNC(OC(C)(C)C)=O)CC2
Catalog No.: 198297
Purity: 95%
MF: C20H30N2O4
MW: 362.47
Storage: 2-8 degree Celsius
SMILES: O=C(OCC1=CC=CC=C1)N[C@H]2CC[C@@H](CNC(OC(C)(C)C)=O)CC2
CAS No.:2384110-35-2;benzyl cis-(4-(((tert-butoxycarbonyl)amino)methyl)cyclohexyl)carbamate;ChemShuttle distinguishes itself as a custom chemical synthesis company by providing unique building blocks such as the benzyl cis-(4-(((tert-butoxycarbonyl)amino)methyl)cyclohexyl)carbamate (CAS No.:2384110-35-2). This compound combines the reactivity of a Boc-protected amine with the stability imparted by the benzyl carbamate and cyclohexyl substituents, making it an excellent candidate for custom compound synthesis. As a chemical online mall, we recognize the growing demand for such specialized heterocycles in the pharmaceutical industry. The tert-butoxycarbonyl and benzyl carbamate groups provide valuable points for deprotection strategies, while the cyclohexyl core adds structural diversity. Researchers can benefit from our expertise in small molecules synthesis to produce this compound in the quantities needed for their experiments, supported by our full-time equivalent model that dedicates resources specifically to their projects.
Reviews
Write Your Own Review