benzyl 3-(hydroxymethyl)piperazine-1-carboxylate hydrochloride
$200.00
CAS No.: 1159825-20-3
Catalog No.: 138412
Purity: 95%
MF: C13H19ClN2O3
MW: 286.759
Storage: 2-8 degree Celsius
SMILES: Cl.OCC1CN(CCN1)C(=O)OCC1=CC=CC=C1
Catalog No.: 138412
Purity: 95%
MF: C13H19ClN2O3
MW: 286.759
Storage: 2-8 degree Celsius
SMILES: Cl.OCC1CN(CCN1)C(=O)OCC1=CC=CC=C1
benzyl 3-(hydroxymethyl)piperazine-1-carboxylate hydrochloride; CAS No.:1159825-20-3; benzyl 3-(hydroxymethyl)piperazine-1-carboxylate hydrochloride. ChemShuttle, a custom chemical synthesis company, provides various chemical blocks. The compound benzyl 3 - (hydroxymethyl)piperazine - 1 - carboxylate hydrochloride (CAS No.:1159825-20-3) is one of the chemical blocks. It can be used as a building block in the synthesis of more complex organic molecules. Chemical blocks are fundamental units that can be combined to create new compounds with desired properties. ChemShuttle's chemical blocks collection is extensive and diverse to support various research and industrial applications.
Reviews
Write Your Own Review