![tert-butyl 1-amino-7-azaspiro[3.5]nonane-7-carboxylate hydrochloride](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171646_1.jpg)
![tert-butyl 2,6-diazaspiro[4.5]decane-2-carboxylate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171674_1.jpg)
benzyl 2,7-diazaspiro[4.4]nonane-2-carboxylate
$195.00
CAS No.: 1086394-74-2
Catalog No.: 171673
Purity: 95%
MF: C15H20N2O2
MW: 260.337
Storage: 2-8 degree Celsius
SMILES: O=C(OCC1=CC=CC=C1)N1CCC2(CCNC2)C1
Catalog No.: 171673
Purity: 95%
MF: C15H20N2O2
MW: 260.337
Storage: 2-8 degree Celsius
SMILES: O=C(OCC1=CC=CC=C1)N1CCC2(CCNC2)C1
benzyl 2,7-diazaspiro[4.4]nonane-2-carboxylate; CAS No.: 1086394-74-2; benzyl 2,7-diazaspiro[4.4]nonane-2-carboxylate is a cycle compound and a pharma building block. As a product offered by ChemShuttle, a leading chemicals distributor, it is suitable for custom synthesis in the pharmaceutical field. The spirocyclic structure along with the nitrogen and ester functional groups makes it a promising starting material for creating bioactive molecules. In drug development, it can be used to construct compounds that interact with specific biological targets, potentially leading to the discovery of new medications. ChemShuttle's custom synthesis capabilities assist in harnessing the potential of this compound for pharmaceutical research.
Reviews
Write Your Own Review