AZD-4635; HTL-1071
$250.00
CAS No.: 1321514-06-0
Catalog No.: 184944
Purity: 95%
MF: C15H11ClFN5
MW: 315.739
Storage: 2-8 degree Celsius
SMILES: CC1=CC(=CC(Cl)=N1)C1=C(N=C(N)N=N1)C1=CC=C(F)C=C1
Catalog No.: 184944
Purity: 95%
MF: C15H11ClFN5
MW: 315.739
Storage: 2-8 degree Celsius
SMILES: CC1=CC(=CC(Cl)=N1)C1=C(N=C(N)N=N1)C1=CC=C(F)C=C1
6-(2-chloro-6-methylpyridin-4-yl)-5-(4-fluorophenyl)-1,2,4-triazin-3-amine; CAS No.: 20852-11-3 This chemical is integral to the development of advanced adhesives, which are used in construction and manufacturing. Its bonding strength and durability are critical. ChemShuttle supports its production with tailored synthesis and efficient logistics.
Reviews
Write Your Own Review