6-hydroxyquinoline-2-carboxylic acid
$450.00
CAS No.: 75434-18-3
Catalog No.: 170029
Purity: 95%
MF: C10H7NO3
MW: 189.17
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=NC2=CC=C(O)C=C2C=C1
Catalog No.: 170029
Purity: 95%
MF: C10H7NO3
MW: 189.17
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=NC2=CC=C(O)C=C2C=C1
6-hydroxyquinoline-2-carboxylic acid; CAS No.: 75434-18-3; 6-hydroxyquinoline-2-carboxylic acid is part of ChemShuttle's collection of building blocks for drug discovery. This hydroxy-substituted quinoline serves as a valuable building block in creating complex pharmaceutical molecules, aligning with the company's role as a provider of various organic chemicals. As a custom synthesis company, ChemShuttle offers specialized building blocks that support diverse medicinal chemistry initiatives. Researchers can access this and other specialized compounds through the company's chemical online mall, benefiting from high-quality products that ensure reliability in their scientific research.
Reviews
Write Your Own Review