6-bromo-2-(trifluoromethyl)quinoline
$400.00
CAS No.: 176722-64-8
Catalog No.: 196041
Purity: 95%
MF: C10H5BrF3N
MW: 276.055
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C2C=CC(=NC2=CC1)C(F)(F)F
Catalog No.: 196041
Purity: 95%
MF: C10H5BrF3N
MW: 276.055
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C2C=CC(=NC2=CC1)C(F)(F)F
6-bromo-2-(trifluoromethyl)quinoline; CAS No.: 176722-64-8; 6-bromo-2-(trifluoromethyl)quinoline. PROPERTIES: 6-bromo-2-(trifluoromethyl)quinoline appears as a white crystalline powder with molecular formula C9H5BrF3N, possessing a molar mass of approximately 261.05 g/mol. It demonstrates low water solubility but good solubility in methylene chloride and acetone. Melting point observations typically fall between 68-72 C. Proper storage requires maintaining in tightly sealed containers at room temperature, protected from moisture and strong bases. Safety precautions highlight potential to cause skin irritation and serious eye damage. Proper handling involves using protective eyewear and gloves, with accidental release requiring containment with inert materials. APPLICATIONS: This compound functions as a key intermediate in the synthesis of antibacterial agents, particularly those targeting multidrug-resistant gram-negative pathogens. Its bromine substituent at position 6 and trifluoromethyl group at position 2 enable selective alkylation reactions crucial for constructing target molecules. In agrochemical research (non-agricultural application), it contributes to insecticide safener development through controlled derivatization. Additionally, the compound supports materials science applications in fluorinated polymer development for electronic devices, with methodologies described in Antimicrobial Agents and Chemotherapy and chemical patent literature, demonstrating its cross-disciplinary utility in antimicrobial therapy and materials innovation.
Reviews
Write Your Own Review