5-(methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid
$195.00
CAS No.: 117860-56-7
Catalog No.: 171543
Purity: 95%
MF: C7H8N2O4
MW: 184.151
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=CC(=NN1C)C(O)=O
Catalog No.: 171543
Purity: 95%
MF: C7H8N2O4
MW: 184.151
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=CC(=NN1C)C(O)=O
5-(methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid; CAS No.: 117860-56-7; 5-(methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid is a screening compound provided by ChemShuttle, a worldwide chemical supplier. It is used in CRO chemical synthesis, helping to screen for bioactive molecules. This compound can be employed in the discovery of new drugs and chemical products by identifying molecules with specific biological activities, driving the advancement of scientific research and development.
Reviews
Write Your Own Review