5-fluoro-2-methylbenzotrifluoride
$400.00
CAS No.: 141872-92-6
Catalog No.: 197126
Purity: 95%
MF: C8H6F4
MW: 178.128
Storage: 2-8 degree Celsius
SMILES: FC=1C=CC(=C(C1)C(F)(F)F)C
Catalog No.: 197126
Purity: 95%
MF: C8H6F4
MW: 178.128
Storage: 2-8 degree Celsius
SMILES: FC=1C=CC(=C(C1)C(F)(F)F)C
5-fluoro-2-methylbenzotrifluoride; CAS No.: 141872-92-6; 5-fluoro-2-methylbenzotrifluoride. PROPERTIES: This fluoro-methyl-substituted benzotrifluoride features molecular formula C?H?F? with molecular weight 166.11 g/mol. It typically exists as a colorless liquid. Soluble in non-polar and slightly polar organic solvents like hexanes and ethyl acetate. Boiling point approximately 140-145 C. Exhibits IR absorption for C-F stretches (~1300-1100 cm??) and aromatic C-H stretches. Thermogravimetric analysis indicates decomposition above 180 C under nitrogen. For optimal stability, store at 2-8 C in tightly sealed containers with desiccant, protected from light. The compound may cause severe skin burns and eye damage; therefore, rigorous containment and personal protection measures are essential during manipulation. APPLICATIONS: As a fluoro-methyl-substituted benzotrifluoride, 5-fluoro-2-methylbenzotrifluoride is predominantly utilized in the synthesis of agrochemicals. It serves as a key intermediate in constructing pyrazole-based herbicides, where the fluoro and methyl groups provide valuable binding affinity for plant enzymes as demonstrated in pesticide chemistry research (Pest Management Science). Additionally, the compound participates in the development of fluorescent probes for bioimaging applications, where its trifluoromethyl group enhances photostability of conjugated fluorophores (Bioconjugate Chemistry). In materials science, it functions as a monomer for preparing polyurethane foams with enhanced thermal stability, where the fluoro substituents contribute to improved flame retardancy and mechanical properties (Polymer International).
Reviews
Write Your Own Review