5-bromo-2-chloro-4-nitropyridine 1-oxide
$100.00
CAS No.: 1379366-01-4
Catalog No.: 133436
Purity: 95%
MF: C5H2BrClN2O3
MW: 253.439
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=CC(Cl)=[N+]([O-])C=C1Br
Catalog No.: 133436
Purity: 95%
MF: C5H2BrClN2O3
MW: 253.439
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=CC(Cl)=[N+]([O-])C=C1Br
5-bromo-2-chloro-4-nitropyridine 1-oxide; CAS No.: 1379366-01-4: This compound serves as a crucial building block in the synthesis of bioactive molecules, particularly in the field of immunology. Its downstream uses include the development of immunotherapies, offering new avenues for treating complex diseases.
Reviews
Write Your Own Review