5-bromo-2-chloro-4-fluorobenzyl cyanide

5-bromo-2-chloro-4-fluorobenzyl cyanide

5-bromo-1-fluoro-3-methoxy-2-nitrobenzene

5-bromo-1-fluoro-3-methoxy-2-nitrobenzene

5-bromo-2-chloro-4-fluorobenzaldehyde

$200.00
CAS No.: 1782815-29-5
Catalog No.: 194079
Purity: 95%
MF: C7H3BrClFO
MW: 237.455
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=CC(=C(C=O)C1)Cl)F
Availability:
In stock
SKU
194079
  • Size
    Price
    Stock
    Estimated Shipping Time
5-bromo-2-chloro-4-fluorobenzaldehyde; CAS No.: 1782815-29-5; 5-bromo-2-chloro-4-fluorobenzaldehyde. PROPERTIES: 5-bromo-2-chloro-4-fluorobenzaldehyde is a crystalline solid. Its molecular formula is C7H4BrClFO, and the molecular weight is approximately 252.47 g/mol. The compound has a melting point of around 55-57 C. It is moderately soluble in common organic solvents such as ether and chloroform, but is insoluble in water. For stable storage, it should be kept in a tightly sealed container in a cool, dry place, preferably at temperatures below 10 C. As a compound containing bromine, chlorine, and fluorine atoms, it may pose certain health and environmental risks. When handling it, protective gloves, eye protection, and a lab coat should be worn. In case of accidental release into the environment, appropriate cleanup measures should be taken. APPLICATIONS: In organic synthesis, 5-bromo-2-chloro-4-fluorobenzaldehyde can act as a valuable building block. The aldehyde group can undergo reactions such as nucleophilic addition, oxidation, and reduction. The bromine, chlorine, and fluorine substituents provide multiple sites for further functionalization and can influence the electronic properties of the aromatic ring. In the pharmaceutical industry, derivatives of 5-bromo-2-chloro-4-fluorobenzaldehyde can be explored as potential drug candidates. For example, in the development of certain anti-cancer drugs, the substituents of this compound can be used to design drugs that specifically target cancer cells and inhibit their growth (as noted in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where the combination of halogen atoms and the aldehyde group can affect the material's properties (as described in materials chemistry literature).

Reviews

Write Your Own Review
You're reviewing:5-bromo-2-chloro-4-fluorobenzaldehyde
Your Rating