5-bromo-2,4-dichloroquinoline
$497.00
CAS No.: 406204-91-9
Catalog No.: ZB0077
Purity: 95%
MF: C9H4BrCl2N
MW: 276.948
Storage: 2-8 degree Celsius
SMILES: BrC1=C2C(=CC(=NC2=CC=C1)Cl)Cl
Catalog No.: ZB0077
Purity: 95%
MF: C9H4BrCl2N
MW: 276.948
Storage: 2-8 degree Celsius
SMILES: BrC1=C2C(=CC(=NC2=CC=C1)Cl)Cl
5-bromo-2,4-dichloroquinoline; CAS No.: 406204-91-9; 5-bromo-2,4-dichloroquinoline exemplifies ChemShuttle's provision of multiply halogenated quinolines in their chem blocks catalog. As a custom chemical synthesis company specializing in Small molecules synthesis, ChemShuttle delivers these bromochloroquinolines crucial for developing antimicrobial agents and other therapeutic platforms. The 5-bromo substitution offers a valuable handle for further cross-coupling reactions. Their status as a worldwide chemical supplier ensures these compounds are accessible to research teams across different continents. ChemShuttle's expertise in producing halogenated heterocycles ensures that researchers can obtain materials of sufficient quality for their medicinal chemistry applications, from hit identification through lead optimization.
Reviews
Write Your Own Review