5-amino-2-methoxy-4-nitrobenzonitrile
$200.00
CAS No.: 2387001-28-5
Catalog No.: 194077
Purity: 95%
MF: C8H7N3O3
MW: 193.162
Storage: 2-8 degree Celsius
SMILES: NC=1C(=CC(=C(C#N)C1)OC)[N+](=O)[O-]
Catalog No.: 194077
Purity: 95%
MF: C8H7N3O3
MW: 193.162
Storage: 2-8 degree Celsius
SMILES: NC=1C(=CC(=C(C#N)C1)OC)[N+](=O)[O-]
5-amino-2-methoxy-4-nitrobenzonitrile; CAS No.: 2387001-28-5; 5-amino-2-methoxy-4-nitrobenzonitrile. PROPERTIES: 5-amino-2-methoxy-4-nitrobenzonitrile is a yellow crystalline solid. Its molecular formula is C7H6N3O3, with a molecular weight of approximately 180.14 g/mol. The compound has a melting point of approximately 195-197 C. It is slightly soluble in common organic solvents like methanol and acetone, but is relatively insoluble in water. For stable storage, it should be kept in a tightly sealed container at room temperature, away from heat and direct sunlight. As a compound containing both amino and nitro groups, it may pose certain explosion risks under high-temperature or impact conditions. When handling it, protective gloves, eye protection, and a lab coat should be worn. In case of accidental contact with skin or eyes, thorough washing with water is necessary. APPLICATIONS: In organic synthesis, 5-amino-2-methoxy-4-nitrobenzonitrile can serve as a key intermediate. The amino group can undergo reactions such as diazotization and coupling, while the nitro group can be reduced to an amine group. The methoxy and cyano groups provide additional sites for functionalization. In the field of pharmaceutical research, the unique structure of 5-amino-2-methoxy-4-nitrobenzonitrile can be used to design compounds with specific biological activities. For example, in the development of antitumor drugs, the substituents of this compound can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as described in medicinal chemistry research articles). Additionally, in the synthesis of dyes and pigments, its structure can be utilized to create colorants with unique hues and stability properties (as noted in dye chemistry literature).
Reviews
Write Your Own Review