4-propylphenylacetic acid
$250.00
CAS No.: 26114-12-5
Catalog No.: 194074
Purity: 95%
MF: C11H14O2
MW: 178.231
Storage: 2-8 degree Celsius
SMILES: C(CC)C1=CC=C(C=C1)CC(=O)O
Catalog No.: 194074
Purity: 95%
MF: C11H14O2
MW: 178.231
Storage: 2-8 degree Celsius
SMILES: C(CC)C1=CC=C(C=C1)CC(=O)O
4-propylphenylacetic acid; CAS No.: 26114-12-5; 4-propylphenylacetic acid. PROPERTIES: 4-propylphenylacetic acid is a white crystalline powder. Its molecular formula is C11H14O2, with a molecular weight of approximately 178.23 g/mol. The compound has a melting point of approximately 68-70 C. It is slightly soluble in water but dissolves well in organic solvents such as acetone and ethyl acetate. Proper storage requires keeping it in a sealed container at room temperature, away from direct sunlight and heat sources. When handling this compound, appropriate safety measures include wearing protective gloves and eye protection. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In the chemical industry, 4-propylphenylacetic acid can be used as a raw material for the synthesis of various organic compounds. The carboxylic acid group can undergo reactions such as esterification and formation of amides. The propyl substituent on the benzene ring can affect the physical and chemical properties of the derived compounds. In the field of flavor chemistry, derivatives of 4-propylphenylacetic acid can be used to create flavoring agents with unique taste profiles. For instance, esters derived from 4-propylphenylacetic acid can impart fruity or floral notes to food products (as described in flavor chemistry research articles). Furthermore, in the pharmaceutical sector, 4-propylphenylacetic acid can serve as a starting material for the synthesis of non-steroidal anti-inflammatory drugs (NSAIDs). By modifying the structure of 4-propylphenylacetic acid, compounds with improved anti-inflammatory and analgesic effects can be obtained (as mentioned in pharmaceutical research papers).
Reviews
Write Your Own Review