4-phenoxybenzenesulfonyl chloride
$250.00
CAS No.: 1623-92-3
Catalog No.: 109076
Purity: 95%
MF: C12H9ClO3S
MW: 268.721
Storage: 2-8 degree Celsius
SMILES: ClS(=O)(=O)C1=CC=C(OC2=CC=CC=C2)C=C1
Catalog No.: 109076
Purity: 95%
MF: C12H9ClO3S
MW: 268.721
Storage: 2-8 degree Celsius
SMILES: ClS(=O)(=O)C1=CC=C(OC2=CC=CC=C2)C=C1
4-phenoxybenzenesulfonyl chloride; CAS No.: 1623-92-3; 4-phenoxybenzenesulfonyl chloride is considered a cycle compound within ChemShuttle's product classification. This designation highlights its role as part of a series of compounds that can be used in cyclical chemical processes or as part of a compound library. As a cycle compound, 4-phenoxybenzenesulfonyl chloride offers researchers a specific molecular structure that can be incorporated into various synthetic pathways. ChemShuttle's inclusion of this compound in its cycle compounds category reflects the company's understanding of the diverse needs in chemical research. The product's CAS No.: 1623-92-3 enables precise identification and selection for researchers requiring this particular sulfonyl chloride. By categorizing 4-phenoxybenzenesulfonyl chloride as a cycle compound, ChemShuttle helps researchers quickly identify compounds that may be relevant to their cyclical reaction systems or compound screening processes.
Reviews
Write Your Own Review