2'-chloro-6'-fluoroacetophenone

2'-chloro-6'-fluoroacetophenone

4-(chloromethyl)-1-fluoro-2-nitrobenzene

4-(chloromethyl)-1-fluoro-2-nitrobenzene

4-fluoro-2-methyl-5-nitrobenzoic acid

$200.00
CAS No.: 64695-92-7
Catalog No.: 194930
Purity: 95%
MF: C8H6FNO4
MW: 199.137
Storage: 2-8 degree Celsius
SMILES: FC1=CC(=C(C(=O)O)C=C1[N+](=O)[O-])C
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194930
  • Size
    Price
    Stock
    Estimated Shipping Time
4-fluoro-2-methyl-5-nitrobenzoic acid; CAS No.: 64695-92-7; 4-fluoro-2-methyl-5-nitrobenzoic acid. PROPERTIES: 4-fluoro-2-methyl-5-nitrobenzoic acid is a crystalline solid. Its molecular formula is C8H6FNO4, and the molecular weight is approximately 199.14 g/mol. The compound has a melting point of approximately 160-162 C. It is moderately soluble in common organic solvents such as methanol and dimethylformamide, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzene ring, a fluoro group, a methyl group, and a nitro group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 4-fluoro-2-methyl-5-nitrobenzoic acid serves as a versatile intermediate. The nitro group can be reduced to an amine group. The fluoro and methyl groups provide specific electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 4-fluoro-2-methyl-5-nitrobenzoic acid can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:4-fluoro-2-methyl-5-nitrobenzoic acid
Your Rating