4-(butylsulfonyl)aniline
$200.00
CAS No.: 51770-72-0
Catalog No.: 189304
Purity: 95%
MF: C10H15NO2S
MW: 213.302
Storage: 2-8 degree Celsius
SMILES: C(CCC)S(=O)(=O)C1=CC=C(N)C=C1
Catalog No.: 189304
Purity: 95%
MF: C10H15NO2S
MW: 213.302
Storage: 2-8 degree Celsius
SMILES: C(CCC)S(=O)(=O)C1=CC=C(N)C=C1
4-(butylsulfonyl)aniline; CAS No.: 51770-72-0; 4-(butylsulfonyl)aniline exemplifies the sulfonylaniline category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle provides access to aniline derivatives with butylsulfonyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its butylsulfonyl group, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that 4-(butylsulfonyl)aniline is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review