4-bromoisophthalic acid
$375.00
CAS No.: 6939-93-1
Catalog No.: 189373
Purity: 95%
MF: C8H5BrO4
MW: 245.028
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C(=O)O)C=C1)C(=O)O
Catalog No.: 189373
Purity: 95%
MF: C8H5BrO4
MW: 245.028
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C(=O)O)C=C1)C(=O)O
4-bromoisophthalic acid; CAS No.: 6939-93-1; 4-bromoisophthalic acid belongs to Chem Shuttle's collection of brominated aromatic acids that serve as key intermediates in organic synthesis. As a custom chemical synthesis company, Chem Shuttle specializes in producing isophthalic acid derivatives with bromo substituents that are crucial for the development of various pharmaceuticals and agrochemicals. This compound, with its bromo group, serves as a valuable building block for the synthesis of bioactive molecules with specific receptor affinities. Chem Shuttle's online chemical store provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that 4-bromoisophthalic acid is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review