4-bromo-3-(trifluoromethyl)benzene-1-sulfonyl chloride
$300.00
CAS No.: 351003-47-9
Catalog No.: 133761
Purity: 95%
MF: C7H3BrClF3O2S
MW: 323.517
Storage: 2-8 degree Celsius
SMILES: FC(F)(F)C1=C(Br)C=CC(=C1)S(Cl)(=O)=O
Catalog No.: 133761
Purity: 95%
MF: C7H3BrClF3O2S
MW: 323.517
Storage: 2-8 degree Celsius
SMILES: FC(F)(F)C1=C(Br)C=CC(=C1)S(Cl)(=O)=O
4-bromo-3-(trifluoromethyl)benzene-1-sulfonyl chloride; CAS No.: 351003-47-9; 4-bromo-3-(trifluoromethyl)benzene-1-sulfonyl chloride exemplifies ChemShuttle's diverse product range as a custom chemical synthesis company specializing in halogenated and fluorinated building blocks. This key intermediates compound serves as a valuable starting material for developing new pharmaceutical agents with unique pharmacological profiles. Our chemical synthesis companies provide reliable access to high-purity brominated trifluoromethyl benzene sulfonyl chloride derivatives essential for modern medicinal chemistry. The sulfonyl chloride group enables diverse bioconjugation reactions, supporting CRO chemical synthesis projects in constructing complex molecular frameworks. As a worldwide chemical supplier, ChemShuttle ensures consistent quality and timely delivery, making this compound ideal for Small molecules synthesis and facilitating efficient drug discovery processes across diverse research environments.
Reviews
Write Your Own Review