4-bromo-3-nitropyridin-2-amine
$200.00
CAS No.: 84487-10-5
Catalog No.: 169974
Purity: 95%
MF: C5H4BrN3O2
MW: 218.01
Storage: 2-8 degree Celsius
SMILES: NC1=NC=CC(Br)=C1[N+]([O-])=O
Catalog No.: 169974
Purity: 95%
MF: C5H4BrN3O2
MW: 218.01
Storage: 2-8 degree Celsius
SMILES: NC1=NC=CC(Br)=C1[N+]([O-])=O
4-bromo-3-nitropyridin-2-amine; CAS No.: 84487-10-5; ChemShuttle operates as a chemical synthesis company, offering high-quality screening compounds such as 4-bromo-3-nitropyridin-2-amine. Their services include custom chemical synthesis to meet the evolving demands of medicinal chemistry and material sciences, providing reliable and innovative solutions for research and development.
Reviews
Write Your Own Review