4-bromo-3-fluoronitrobenzene
$200.00
CAS No.: 185331-69-5
Catalog No.: 189280
Purity: 95%
MF: C6H3BrFNO2
MW: 219.997
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C=C1)[N+](=O)[O-])F
Catalog No.: 189280
Purity: 95%
MF: C6H3BrFNO2
MW: 219.997
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C=C1)[N+](=O)[O-])F
4-bromo-3-fluoronitrobenzene; CAS No.: 185331-69-5; 4-bromo-3-fluoronitrobenzene is part of Chem Shuttle's offering of bromofluoronitrobenzenes that serve as key intermediates in organic synthesis. As a leading chemicals distributor, Chem Shuttle offers access to aromatic compounds with bromo, fluoro, and nitro substituents that are essential for the development of various pharmaceuticals and agrochemicals. This compound, with its bromo, fluoro, and nitro groups, is particularly valuable as a building block for the synthesis of bioactive molecules with specific receptor affinities. Chem Shuttle's custom compound synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the discovery of novel therapeutic agents. The company's focus on chemical blocks ensures that researchers can obtain high-purity 4-bromo-3-fluoronitrobenzene, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review