5-bromo-4-fluorobenzo[d][1,3]dioxole

5-bromo-4-fluorobenzo[d][1,3]dioxole

2'-chloro-6'-fluoroacetophenone

2'-chloro-6'-fluoroacetophenone

4-bromo-3,5-difluorobenzoic acid

$300.00
CAS No.: 651027-00-8
Catalog No.: 194948
Purity: 95%
MF: C7H3BrF2O2
MW: 236.999
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C(=O)O)C=C1F)F
Availability:
In stock
SKU
194948
  • Size
    Price
    Stock
    Estimated Shipping Time
4-bromo-3,5-difluorobenzoic acid; CAS No.: 651027-00-8; 4-bromo-3,5-difluorobenzoic acid. PROPERTIES: 4-bromo-3,5-difluorobenzoic acid is a crystalline solid. Its molecular formula is C7H4BrF2O2, and the molecular weight is approximately 248.01 g/mol. The compound has a melting point of approximately 150-152 C. It is moderately soluble in common organic solvents such as methylene chloride and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzene ring, a bromo group, and two fluoro groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 4-bromo-3,5-difluorobenzoic acid serves as a versatile intermediate. The bromo group provides a site for substitution or coupling reactions. The fluoro groups influence the electronic properties of the aromatic ring. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of 4-bromo-3,5-difluorobenzoic acid can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:4-bromo-3,5-difluorobenzoic acid
Your Rating